CAS 16517-11-6|Pentatriacontafluorooctadecanoic acid
Introduction:Basic information about CAS 16517-11-6|Pentatriacontafluorooctadecanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pentatriacontafluorooctadecanoic acid | ||
|---|---|---|---|
| CAS Number | 16517-11-6 | Molecular Weight | 914.143 |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 331.8±37.0 °C at 760 mmHg |
| Molecular Formula | C18HF35O2 | Melting Point | 162-164°C |
| MSDS | / | Flash Point | 154.5±26.5 °C |
Names
| Name | Perfluorooctadecanoic Acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.8±37.0 °C at 760 mmHg |
| Melting Point | 162-164°C |
| Molecular Formula | C18HF35O2 |
| Molecular Weight | 914.143 |
| Flash Point | 154.5±26.5 °C |
| Exact Mass | 913.941772 |
| PSA | 37.30000 |
| LogP | 16.64 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.288 |
| InChIKey | ZTSDOGSKTICNPQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Safety Information
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
Synonyms
| Octadecanoic acid, pentatriacontafluoro- |
| MFCD00198021 |
| Octadecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-pentatriacontafluoro- |
| Pentatriacontafluorooctadecanoic acid |
| Perfluorooctadecanoic acid |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-pentatriacontafluorooctadecanoic acid |
| EINECS 240-582-5 |
