Introduction：Basic information about CAS 253585-83-0|4-phenyl-2-(piperazin-1-yl)thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-phenyl-2-(piperazin-1-yl)thiazole |
|---|
| CAS Number | 253585-83-0 | Molecular Weight | 445.57300 |
|---|
| Density | 1.112g/cm3 | Boiling Point | 594.723ºC at 760 mmHg |
|---|
| Molecular Formula | C27H27NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 313.478ºC |
|---|
Names
| Name | 1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(O-benzoyloxime) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.112g/cm3 |
|---|
| Boiling Point | 594.723ºC at 760 mmHg |
|---|
| Molecular Formula | C27H27NO3S |
|---|
| Molecular Weight | 445.57300 |
|---|
| Flash Point | 313.478ºC |
|---|
| Exact Mass | 445.17100 |
|---|
| PSA | 81.03000 |
|---|
| LogP | 7.20390 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | LOCXTTRLSIDGPS-AZPGRJICSA-N |
|---|
| SMILES | CCCCCCC(=NOC(=O)c1ccccc1)C(=O)c1ccc(Sc2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-phenyl-2-piperazinyl-1,3-thiazole |
| 1-(4-phenylthiophenyl)-n-octane-1,2-dione-2-benzoic acid oxime ester |
| 1-(4-Phenyl-2-thiazolyl)piperazine |
| 2-((Benzoyloxy)imino)-1-(4-(phenylthio)phenyl)octan-1-one |
| N-(4-phenyl-2-thiazolyl)piperazine |
| 1-[4-(phenylthio)phenyl]-octane-1,2-dione-2-(O-benzoyloxime) |
| 4-phenyl-2-(1-piperazinyl)thiazole |
| 1-(4-Phenylthiazol-2-yl)-piperazin |
| 1-(4-phenyl-thiazol-2-yl)-piperazine |
| 1-(4-phenyl-1,3-thiazol-2-yl)piperazine |
| 4-phenyl-2-(piperazin-1-yl)thiazole |
| OXE-01 |
