Introduction：Basic information about CAS 61278-54-4|5-(p-nitrophenyl)-1-phenylimidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(p-nitrophenyl)-1-phenylimidazole |
|---|
| CAS Number | 61278-54-4 | Molecular Weight | 265.26700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H11N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(p-nitrophenyl)-1-phenylimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H11N3O2 |
|---|
| Molecular Weight | 265.26700 |
|---|
| Exact Mass | 265.08500 |
|---|
| PSA | 63.64000 |
|---|
| LogP | 3.97070 |
|---|
| InChIKey | ZSJKEZJWFBXQDZ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2cncn2-c2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933290090 |
|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1H-Tetrazole,5-(4-nitrophenoxy) |
| 5-p-Nitrophenyl-1-phenylimidazol |
| 5-p-nitrophenoxytetrazole |
| 5-(4-nitrophenoxy)tetrazole |
| 5-(p-Nitro-phenoxy)-tetrazol |
| 5-(4-nitro-phenoxy)-1H-tetrazole |
| 5-(4-nitro-phenyl)-1-phenyl-1H-imidazole |
