Introduction:Basic information about CAS 3636-29-1|5,5-Dichloro-2,2-dihydroxydiphenyl sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5-Dichloro-2,2-dihydroxydiphenyl sulfone |
|---|
| CAS Number | 3636-29-1 | Molecular Weight | 319.16100 |
|---|
| Density | 1.607g/cm3 | Boiling Point | 534.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2O4S | Melting Point | 188ºC |
|---|
| MSDS | / | Flash Point | 277.2ºC |
|---|
Names
| Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfonylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.607g/cm3 |
|---|
| Boiling Point | 534.7ºC at 760 mmHg |
|---|
| Melting Point | 188ºC |
|---|
| Molecular Formula | C12H8Cl2O4S |
|---|
| Molecular Weight | 319.16100 |
|---|
| Flash Point | 277.2ºC |
|---|
| Exact Mass | 317.95200 |
|---|
| PSA | 82.98000 |
|---|
| LogP | 4.31820 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | LYNCCKPDWATQNR-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1cc(Cl)ccc1O)c1cc(Cl)ccc1O |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4-chloro-2-[(5-chloro-2-hydroxyphenyl)sulfonyl]phenol |
| 4,4'-dichloro-2,2'-sulfonyl-di-phenol |
| 5,2'-dihydroxydiphenyl sulfone |
| 4,4'-Dichlor-2,2'-sulfonyl-di-phenol |
| bis-2-hydroxy-5-chlorophenyl sulfone |
| 2,5'-dichlorodiphenyl sulfone |
| Bis-(5-chlor-2-hydroxy-phenyl)-sulfon |