Introduction：Basic information about CAS 138113-07-2|7-methoxy-1-naphthaleneacetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-methoxy-1-naphthaleneacetamide |
|---|
| CAS Number | 138113-07-2 | Molecular Weight | 215.248 |
|---|
| Density | 1.188 | Boiling Point | 452.7±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H13NO2 | Melting Point | 200 °C |
|---|
| MSDS | / | Flash Point | 249.1±20.3 °C |
|---|
Names
| Name | 2-(7-methoxynaphthalen-1-yl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.188 |
|---|
| Boiling Point | 452.7±28.0 °C at 760 mmHg |
|---|
| Melting Point | 200 °C |
|---|
| Molecular Formula | C13H13NO2 |
|---|
| Molecular Weight | 215.248 |
|---|
| Flash Point | 249.1±20.3 °C |
|---|
| Exact Mass | 215.094635 |
|---|
| PSA | 53.31000 |
|---|
| LogP | 1.60 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | LGYBVRIYYBHYCX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2cccc(CC(N)=O)c2c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (7-Methoxy-[1]naphthyl)-essigsaeure-amid |
| (7-methoxy-[1]naphthyl)-acetic acid amide |
| (7-Methoxy-1-naphthyl)acetamide |
| 2-(7-Methoxy-1-naphthyl)acetamide |
| 1-Naphthaleneacetamide,7-methoxy |
| 1-Naphthaleneacetamide, 7-methoxy- |
| 2-(7-methoxy-1-naphthyl) acetic acid |
| 7-methoxy-1-naphthaleneacetamide |
| L66J B1VQ IO1 |
| 2-(7-methoxynaphthalen-1-yl) acetamide |
| Agomelatine Impurity 8 |
| Agomelatine Impurity B |
