Introduction：Basic information about CAS 1375069-02-5|2-(2'-METHYL-[1,1'-BIPHENYL]-3-YL)ACETIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2'-METHYL-[1,1'-BIPHENYL]-3-YL)ACETIC ACID |
|---|
| CAS Number | 1375069-02-5 | Molecular Weight | 226.27000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[3-(2-methylphenyl)phenyl]acetic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.28910 |
|---|
| InChIKey | MBCVVFMOLIMBHJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1-c1cccc(CC(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
