Introduction：Basic information about CAS 134208-17-6|Mazapertine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mazapertine |
|---|
| CAS Number | 134208-17-6 | Molecular Weight | 421.57500 |
|---|
| Density | 1.128g/cm3 | Boiling Point | 583.8ºC at 760 mmHg |
|---|
| Molecular Formula | C26H35N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.9ºC |
|---|
Names
| Name | piperidin-1-yl-[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]phenyl]methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.128g/cm3 |
|---|
| Boiling Point | 583.8ºC at 760 mmHg |
|---|
| Molecular Formula | C26H35N3O2 |
|---|
| Molecular Weight | 421.57500 |
|---|
| Flash Point | 306.9ºC |
|---|
| Exact Mass | 421.27300 |
|---|
| PSA | 36.02000 |
|---|
| LogP | 4.36290 |
|---|
| Vapour Pressure | 1.29E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | ZKZFPRUSWCYSGT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Oc1ccccc1N1CCN(Cc2cccc(C(=O)N3CCCCC3)c2)CC1 |
|---|
Synonyms
| UNII-N0X1XW704P |
| [3-[[4-[2-(1-Methylethoxy)phenyl]-1-piperazinyl]methyl]benzoyl]-piperidine |
| Mazapertine |
| Mazapertine [INN] |
| 1-[3-[[4-[2-(1-methylethoxy)phenyl]-1-piperazinyl]methyl]benzoyl]piperidine |
