Introduction：Basic information about CAS 39757-34-1|Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
|---|
| CAS Number | 39757-34-1 | Molecular Weight | 224.185 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 348.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9FO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.2±17.2 °C |
|---|
Names
| Name | Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 348.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9FO4 |
|---|
| Molecular Weight | 224.185 |
|---|
| Flash Point | 159.2±17.2 °C |
|---|
| Exact Mass | 224.048492 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 1.05 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | PAEDUWHKVNTJMJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(=O)CC(=O)c1ccc(F)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
| F1727-0238 |
| methyl 4-[4-fluorophenyl]-2,4-dioxobutanoate |
| 4-(4-Fluorophenyl)-2,4-dioxo-butyric acid methyl ester |
| Benzenebutanoic acid, 4-fluoro-α,γ-dioxo-, methyl ester |
| Methyl 4-fluoro-a,g-dioxo-benzenebutanoate |
| methyl 4-(4-fluorophenyl)-2,4-diketobutyrate |
