Introduction:Basic information about CAS 3982-82-9|1,1,5,5-Tetraphenyltetramethyltrisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,5,5-Tetraphenyltetramethyltrisiloxane |
|---|
| CAS Number | 3982-82-9 | Molecular Weight | 484.809 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 495.8±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H32O2Si3 | Melting Point | -25 °C |
|---|
| MSDS | / | Flash Point | 209.1±24.4 °C |
|---|
Names
| Name | dimethyl-bis[[methyl(diphenyl)silyl]oxy]silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 495.8±28.0 °C at 760 mmHg |
|---|
| Melting Point | -25 °C |
|---|
| Molecular Formula | C28H32O2Si3 |
|---|
| Molecular Weight | 484.809 |
|---|
| Flash Point | 209.1±24.4 °C |
|---|
| Exact Mass | 484.171021 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 11.75 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | YFCVAZGXPLMNDG-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(O[Si](C)(c1ccccc1)c1ccccc1)O[Si](C)(c1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2~8℃,Seal |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1,1,5,5-tetraphenyl-1,3,3,5-tetramethyltrisoloxane |
| 1,1,5,5-tetraphenyl-1,3,3,5-tetramethyltrisiloxane |
| MFCD00053661 |
| 2.2.6.6-tetraphenyl-4.4-dimethyl-2.4.6-trisila-3.5-dioxaheptane |
| Trisiloxane,1,3,3,5-tetramethyl-1,1,5,5-tetraphenyl |
| EINECS 223-620-5 |
| EINECS 222-222-9 |
| Benzene, 1,1',1'',1'''-(1,3,3,5-tetramethyl-1,5-trisiloxanediylidene)tetrakis- |
| Trisiloxane, 1,3,3,5-tetramethyl-1,1,5,5-tetraphenyl- |
| 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane |
| 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyl-trisiloxan |