Introduction:Basic information about CAS 36640-39-8|3-(4-chlorophenyl)-1-phenyl-1H-pyrazole-4-methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-chlorophenyl)-1-phenyl-1H-pyrazole-4-methanol |
|---|
| CAS Number | 36640-39-8 | Molecular Weight | 284.74000 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 482.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H13ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.8ºC |
|---|
Names
| Name | [3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 482.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H13ClN2O |
|---|
| Molecular Weight | 284.74000 |
|---|
| Flash Point | 245.8ºC |
|---|
| Exact Mass | 284.07200 |
|---|
| PSA | 38.05000 |
|---|
| LogP | 3.68500 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | RGRYFKFGOCASDE-UHFFFAOYSA-N |
|---|
| SMILES | OCc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| [3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methanol acid |
| 3-(4-chlorophenyl)-1-phenyl-1H-pyrazole-4-methanol |
| 4-Hydroxymethyl-1-phenyl-3-(p-chlorphenyl)-pyrazol |
| 3-(p-Chlorphenyl)-4-hydroxymethyl-1-phenylpyrazol |
| 3-(p-chlorophenyl)-4-hydroxymethyl-1-phenylpyrazole |
| EINECS 253-145-9 |
| 4-hydroxy-methyl-1-phenyl-3-(p-chlorophenyl)-pyrazol |
| 1h-pyrazole-4-methanol,3-(4-chlorophenyl)-1-phenyl |
| [3-(4-chloro-phenyl)-1-phenyl-1H-pyrazol-4-yl]-methanol |