Introduction:Basic information about CAS 36783-03-6|3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid |
|---|
| CAS Number | 36783-03-6 | Molecular Weight | 257.34900 |
|---|
| Density | 1.215g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H19NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.215g/cm3 |
|---|
| Molecular Formula | C12H19NO3S |
|---|
| Molecular Weight | 257.34900 |
|---|
| Exact Mass | 257.10900 |
|---|
| PSA | 65.99000 |
|---|
| LogP | 3.18000 |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | IBSUMVZKDLDAEK-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCCS(=O)(=O)O)c1cccc(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N-Aethyl-3-methyl-N-<3-sulfopropyl>-anilin |
| EINECS 253-210-1 |
| 3-[ethyl(3-methylphenyl)amino]propane-1-sulfonic acid |
| 3-[ethyl(3-methylphenyl)amino]propanesulfonic acid |
| 3-(Ethyl(3-methylphenyl)amino)propanesulphonic acid |