Introduction:Basic information about CAS 6307-90-0|Benzene,1,2,3-trimethoxy-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1,2,3-trimethoxy-5-nitro- |
|---|
| CAS Number | 6307-90-0 | Molecular Weight | 213.18700 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 341.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.2ºC |
|---|
Names
| Name | 1,2,3-trimethoxy-5-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 341.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO5 |
|---|
| Molecular Weight | 213.18700 |
|---|
| Flash Point | 159.2ºC |
|---|
| Exact Mass | 213.06400 |
|---|
| PSA | 73.51000 |
|---|
| LogP | 2.14380 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | HZXMMBPRQGKMSW-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])cc(OC)c1OC |
|---|
Synonyms
| 5-Nitro-pyrogallol-trimethylaether |
| 1,2,3-trimethoxy-5-nitro-benzene |
| 1,2,3-Trimethoxy-5-nitro-benzol |
| 3,4,5-trimethoxy-1-nitrobenzene |
| 3,4,5-trimethoxynitrobenzene |