Introduction：Basic information about CAS 3695-00-9|Bis(4-methylbenzenesulfon)amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(4-methylbenzenesulfon)amine |
|---|
| CAS Number | 3695-00-9 | Molecular Weight | 325.40300 |
|---|
| Density | 1.343g/cm3 | Boiling Point | 493.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO4S2 | Melting Point | 173 °C |
|---|
| MSDS | / | Flash Point | 252.3ºC |
|---|
Names
| Name | 4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.343g/cm3 |
|---|
| Boiling Point | 493.6ºC at 760 mmHg |
|---|
| Melting Point | 173 °C |
|---|
| Molecular Formula | C14H15NO4S2 |
|---|
| Molecular Weight | 325.40300 |
|---|
| Flash Point | 252.3ºC |
|---|
| Exact Mass | 325.04400 |
|---|
| PSA | 97.07000 |
|---|
| LogP | 4.52310 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | LHWZLUXODWUHLZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| MFCD00014917 |
| di(4-methylobenzenesulfonyl)amine |
| bistosylimide |
| Di-p-Toluenesulfonimide |
| 4-methyl-N-[(4-methylphenyl)sulfonyl]benzenesulfonamide |
| di(4-tosyl)amine |
| Di-p-toluenesulfonamide |
| Bis(4-methylbenzenesulfon)amine |
| 4-methyl-N-tosylbenzenesulfonamide |
| Benzenesulfonamide,4-methyl-N-[(4-methylphenyl)sulfonyl] |
| Bis(p-tolylsulfonyl)amine |
