Introduction：Basic information about CAS 39690-70-5|Bis(vinylsulfonyl)ethane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(vinylsulfonyl)ethane |
|---|
| CAS Number | 39690-70-5 | Molecular Weight | 210.27100 |
|---|
| Density | 1.315 g/cm3 | Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C6H10O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331.8ºC |
|---|
Names
| Name | 1,1-bis(ethenylsulfonyl)ethane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.315 g/cm3 |
|---|
| Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C6H10O4S2 |
|---|
| Molecular Weight | 210.27100 |
|---|
| Flash Point | 331.8ºC |
|---|
| Exact Mass | 210.00200 |
|---|
| PSA | 85.04000 |
|---|
| LogP | 2.26460 |
|---|
| Index of Refraction | 1.5 |
|---|
| InChIKey | ZFTVNHVAISUTAL-UHFFFAOYSA-N |
|---|
| SMILES | C=CS(=O)(=O)C(C)S(=O)(=O)C=C |
|---|
Synonyms
| 1,1'-(ethane-1,2-disulfonyl)-bis-ethene |
| Bis(vinylsulfonyl)ethane |
| I09-0068 |
| 1,2-bis-ethenesulfonyl-ethane |
