Introduction:Basic information about CAS 165669-32-9|4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride |
|---|
| CAS Number | 165669-32-9 | Molecular Weight | 309.79000 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 448.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H12ClNO4S2 | Melting Point | 133ºC |
|---|
| MSDS | USA | Flash Point | 225.1ºC |
|---|
Names
| Name | 4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 448.6ºC at 760mmHg |
|---|
| Melting Point | 133ºC |
|---|
| Molecular Formula | C10H12ClNO4S2 |
|---|
| Molecular Weight | 309.79000 |
|---|
| Flash Point | 225.1ºC |
|---|
| Exact Mass | 308.99000 |
|---|
| PSA | 88.28000 |
|---|
| LogP | 3.49810 |
|---|
| Vapour Pressure | 3.06E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | ZXYZKIFFWKXROK-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
Synonyms
| 4-(pyrrolidine-1-sulfonyl)-benzenesulfonyl chloride |
| 4-(pyrrolidin-1-ylsulfonyl)benzenesulfonyl chloride |
| 4-(1-pyrrolidinylsulfonyl)benzenesulfonyl chloride |