Introduction：Basic information about CAS 135273-01-7|(Fmoc-Cys-OH)2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Fmoc-Cys-OH)2 |
|---|
| CAS Number | 135273-01-7 | Molecular Weight | 684.778 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 925.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C36H32N2O8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 513.7±34.3 °C |
|---|
Names
| Name | (2R)-3-[[(2R)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]disulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 925.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C36H32N2O8S2 |
|---|
| Molecular Weight | 684.778 |
|---|
| Flash Point | 513.7±34.3 °C |
|---|
| Exact Mass | 684.160034 |
|---|
| PSA | 201.86000 |
|---|
| LogP | 9.67 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | IRQYKZZFOSDZHP-ACHIHNKUSA-N |
|---|
| SMILES | O=C(NC(CSSCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| L-Cystine, N,N'-bis[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| N,N'-Bis[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cystine |
| (2R,2'R)-3,3'-Disulfanediylbis(2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)propanoic acid) |
| N,N'-Bis-Fmoc-L-cystine |
