Introduction：Basic information about CAS 13254-04-1|Z-Ile-Gly-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ile-Gly-OH |
|---|
| CAS Number | 13254-04-1 | Molecular Weight | 322.35600 |
|---|
| Density | 1.203g/cm3 | Boiling Point | 582ºC at 760mmHg |
|---|
| Molecular Formula | C16H22N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 305.8ºC |
|---|
Names
| Name | 2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.203g/cm3 |
|---|
| Boiling Point | 582ºC at 760mmHg |
|---|
| Molecular Formula | C16H22N2O5 |
|---|
| Molecular Weight | 322.35600 |
|---|
| Flash Point | 305.8ºC |
|---|
| Exact Mass | 322.15300 |
|---|
| PSA | 104.73000 |
|---|
| LogP | 2.31010 |
|---|
| Vapour Pressure | 2.17E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | RWAYODJQGJVQGX-FZMZJTMJSA-N |
|---|
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NCC(=O)O |
|---|
Synonyms
| EINECS 236-241-5 |
| N-Z-Isoleucin-Glycin |
