Introduction：Basic information about CAS 7764-30-9|2-[(1,3-dioxoisoindol-2-yl)disulfanyl]isoindole-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(1,3-dioxoisoindol-2-yl)disulfanyl]isoindole-1,3-dione |
|---|
| CAS Number | 7764-30-9 | Molecular Weight | 356.37600 |
|---|
| Density | 1.72g/cm3 | Boiling Point | 589.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H8N2O4S2 | Melting Point | 225-220ºC |
|---|
| MSDS | / | Flash Point | 310.2ºC |
|---|
Names
| Name | 2-[(1,3-dioxoisoindol-2-yl)disulfanyl]isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.72g/cm3 |
|---|
| Boiling Point | 589.4ºC at 760 mmHg |
|---|
| Melting Point | 225-220ºC |
|---|
| Molecular Formula | C16H8N2O4S2 |
|---|
| Molecular Weight | 356.37600 |
|---|
| Flash Point | 310.2ºC |
|---|
| Exact Mass | 355.99300 |
|---|
| PSA | 125.36000 |
|---|
| LogP | 2.66600 |
|---|
| Index of Refraction | 1.825 |
|---|
| InChIKey | XVJMNRIABVPIOU-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1SSN1C(=O)c2ccccc2C1=O |
|---|
Synonyms
| Dithiobisphthalimide |
| N,N'-dithiobis(phthalimide) |
| HMS1661D13 |
| diphthalimidodisulfane |
| N,N'-dithiodiphthalimide |
| N,N'-thiobisphthalimide |
| diphthalimidyl disulfide |
