Introduction：Basic information about CAS 39978-57-9|5-Nitrothiophene-2-carbonyl Chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitrothiophene-2-carbonyl Chloride |
|---|
| CAS Number | 39978-57-9 | Molecular Weight | 191.59200 |
|---|
| Density | 1.635g/cm3 | Boiling Point | 299.523ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2ClNO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.947ºC |
|---|
Names
| Name | 5-Nitrothiophene-2-carbonyl Chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.635g/cm3 |
|---|
| Boiling Point | 299.523ºC at 760 mmHg |
|---|
| Molecular Formula | C5H2ClNO3S |
|---|
| Molecular Weight | 191.59200 |
|---|
| Flash Point | 134.947ºC |
|---|
| Exact Mass | 190.94400 |
|---|
| PSA | 91.13000 |
|---|
| LogP | 2.55850 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | BYEANWQDRDXPPA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])s1 |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| Hazard Class | 6.1，8 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Nitro-2-thiophenecarbonyl Chloride |
| 5-Nitro-thiophen-2-carbonylchlorid |
| 2-Thiophenecarbonylchloride,5-nitro |
| 5-nitro-thiophene-2-carbonyl chloride |
| 5-Nitrothiophene-2-formyl Chloride |
| 2-chlorocarbonyl-5-nitrothiophene |
| 5-Nitro-2-thenoyl Chloride |
| 5-nitro-thiophene-2-carboxylic acid chloride |
