Introduction：Basic information about CAS 136384-19-5|5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|
| CAS Number | 136384-19-5 | Molecular Weight | 309.25800 |
|---|
| Density | 1.66g/cm3 | Boiling Point | 417.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Cl2N2S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.5ºC |
|---|
Names
| Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.66g/cm3 |
|---|
| Boiling Point | 417.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Cl2N2S3 |
|---|
| Molecular Weight | 309.25800 |
|---|
| Flash Point | 206.5ºC |
|---|
| Exact Mass | 307.90700 |
|---|
| PSA | 118.12000 |
|---|
| LogP | 4.42590 |
|---|
| Vapour Pressure | 3.45E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.767 |
|---|
| InChIKey | XPKHYWRIWANKDK-UHFFFAOYSA-N |
|---|
| SMILES | S=c1[nH]nc(SCc2ccc(Cl)cc2Cl)s1 |
|---|
Synonyms
| 5-[(2,4-dichlorophenyl)methylthio]-3H-1,3,4-thiadiazole-2-thione |
| 5-(2,4-Dichlorobenzylthio)-2-mercapto-1,3,4 |
| 2-(2,4-dichlorobenzylthio)-1,3,4-thiadiazole-5(4H)-thione |
| 5-(2,4-Dichlorobenzylthio)-2-mercapto-1,3,4-thiadiazole |
