Introduction：Basic information about CAS 25315-19-9|1H-Indene-1,3(2H)-dione, 2-[(3,5-dichloro-4-hydroxyphenyl)methylene]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indene-1,3(2H)-dione, 2-[(3,5-dichloro-4-hydroxyphenyl)methylene]- |
|---|
| CAS Number | 25315-19-9 | Molecular Weight | 319.13900 |
|---|
| Density | 1.582g/cm3 | Boiling Point | 503.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H8Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.6ºC |
|---|
Names
| Name | 2-[(3,5-dichloro-4-hydroxyphenyl)methylidene]indene-1,3-dione |
|---|
Chemical & Physical Properties
| Density | 1.582g/cm3 |
|---|
| Boiling Point | 503.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H8Cl2O3 |
|---|
| Molecular Weight | 319.13900 |
|---|
| Flash Point | 258.6ºC |
|---|
| Exact Mass | 317.98500 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 4.16160 |
|---|
| Vapour Pressure | 8.89E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.736 |
|---|
| InChIKey | WOXYHHTVJHEQBH-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C(=Cc2cc(Cl)c(O)c(Cl)c2)C(=O)c2ccccc21 |
|---|
