Introduction：Basic information about CAS 137-49-5|4-chloro-3-nitro-N-phenylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-3-nitro-N-phenylbenzenesulfonamide |
|---|
| CAS Number | 137-49-5 | Molecular Weight | 312.72900 |
|---|
| Density | 1.545g/cm3 | Boiling Point | 474.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H9ClN2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.8ºC |
|---|
Names
| Name | 4-chloro-3-nitro-N-phenylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.545g/cm3 |
|---|
| Boiling Point | 474.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H9ClN2O4S |
|---|
| Molecular Weight | 312.72900 |
|---|
| Flash Point | 240.8ºC |
|---|
| Exact Mass | 311.99700 |
|---|
| PSA | 100.37000 |
|---|
| LogP | 4.72600 |
|---|
| Vapour Pressure | 3.59E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | BEEGBBKQFMABPW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccccc2)ccc1Cl |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 1-chloro-2-nitrobenzene-4-sulphonic acid phenylamide |
| Benzenesulfonamide,4-chloro-3-nitro-N-phenyl |
| EINECS 137-49-5 |
| 4-phenylaminosulphonyl-2-nitro-chlorobenzene |
| 4-Chloro-3-nitrobenzene sulfonanilide |
| N1-phenyl-3-nitro-4-chlorosulfonamide |
| 4-CHLORO-3-NITROBENZENESULFONANILIDE |
| 4-Chloro-3-nitro-N-phenyl-benzenesulfonamide |
| 4-chloro-3-nitro-N-phenylbenzene-1-sulfonamide |
| N-Phenyl-4-chlor-3-nitro-benzol-sulfonamid |
| 1-Chlor-2-nitro-benzol-sulfonsaeure-(4)-amid |
