Introduction:Basic information about CAS 361377-29-9|fluoxastrobin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fluoxastrobin |
|---|
| CAS Number | 361377-29-9 | Molecular Weight | 458.827 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 497.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H16ClFN4O5 | Melting Point | 103-108° |
|---|
| MSDS | ChineseUSA | Flash Point | 254.6±31.5 °C |
|---|
| Symbol | GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | fluoxastrobin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 497.3±55.0 °C at 760 mmHg |
|---|
| Melting Point | 103-108° |
|---|
| Molecular Formula | C21H16ClFN4O5 |
|---|
| Molecular Weight | 458.827 |
|---|
| Flash Point | 254.6±31.5 °C |
|---|
| Exact Mass | 458.079315 |
|---|
| PSA | 96.65000 |
|---|
| LogP | 5.34 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | UFEODZBUAFNAEU-NLRVBDNBSA-N |
|---|
| SMILES | CON=C(C1=NOCCO1)c1ccccc1Oc1ncnc(Oc2ccccc2Cl)c1F |
|---|
Safety Information
| Symbol | GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H317-H400 |
|---|
| Precautionary Statements | P273-P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xi,N |
|---|
| Risk Phrases | 43-50/53 |
|---|
| Safety Phrases | 36/37-60-61 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
| RTECS | OS9546500 |
|---|
Synonyms
| (E)-(2-{[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxy}phenyl)(5,6-dihydro-1,4,2-dioxazin-3-yl)methanone O-methyloxime |
| (E)-1-(2-{[6-(2-Chlorophenoxy)-5-fluoro-4-pyrimidinyl]oxy}phenyl)-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| fluxastrobin |
| Fluoxastrobin |
| (1E)-[2-[[6-(2-chlorophenoxy)-5-fluoro-4-pyrimidinyl]oxy]phenyl](5,6-dihydro-1,4,2-dioxazin-3-yl)methanone O-methyloxime |
| Methanone, [2-[[6-(2-chlorophenoxy)-5-fluoro-4-pyrimidinyl]oxy]phenyl](5,6-dihydro-1,4,2-dioxazin-3-yl)-, O-methyloxime, (E)- |
| (1E)-1-(2-{[6-(2-chlorophenoxy)-5-fluoropyrimidin-4-yl]oxy}phenyl)-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| (E)-{2-[6-(2-Chlorophenoxy)-5-fluoropyrimidin-4-yloxy]phenyl}(5,6-dihydro-1,4,2-dioxazin-3-yl)methanone O-methyloxime |
| (E)-1-(2-{[6-(2-Chlorophenoxy)-5-fluoropyrimidin-4-yl]oxy}phenyl)-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| (E)-(2-{[6-(2-Chlorphenoxy)-5-fluorpyrimidin-4-yl]oxy}phenyl)(5,6-dihydro-1,4,2-dioxazin-3-yl)methanonO-methyloxim |