Introduction：Basic information about CAS 164982-05-2|Triphenyl-(4-sulfo-butyl)-phosphonium inner salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triphenyl-(4-sulfo-butyl)-phosphonium inner salt |
|---|
| CAS Number | 164982-05-2 | Molecular Weight | 398.45500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H23O3PS | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-triphenylphosphaniumylbutane-1-sulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C22H23O3PS |
|---|
| Molecular Weight | 398.45500 |
|---|
| Exact Mass | 398.11100 |
|---|
| PSA | 96.89000 |
|---|
| LogP | 3.95120 |
|---|
| InChIKey | RKQKXPDRWYNUGZ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)([O-])CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Triphenyl-(4-sulfo-butyl)-phosphonium inner salt |
| 1-(4-sulfonylbutyl)triphenyphosphonium |
| 4-(Triphenylphosphonio)butane-1-sulfonate |
