Introduction：Basic information about CAS 253426-70-9|N-BOC-ALPHA-(PHENYLSULFONYL)CYCLOHEXYLMETHYLAMINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-BOC-ALPHA-(PHENYLSULFONYL)CYCLOHEXYLMETHYLAMINE |
|---|
| CAS Number | 253426-70-9 | Molecular Weight | 353.47600 |
|---|
| Density | 1.153g/cm3 | Boiling Point | 521.224ºC at 760 mmHg |
|---|
| Molecular Formula | C18H27NO4S | Melting Point | 153-157ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 269.027ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl N-[benzenesulfonyl(cyclohexyl)methyl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.153g/cm3 |
|---|
| Boiling Point | 521.224ºC at 760 mmHg |
|---|
| Melting Point | 153-157ºC |
|---|
| Molecular Formula | C18H27NO4S |
|---|
| Molecular Weight | 353.47600 |
|---|
| Flash Point | 269.027ºC |
|---|
| Exact Mass | 353.16600 |
|---|
| PSA | 84.34000 |
|---|
| LogP | 5.17660 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | CHWYBOVSGSJNFE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(C1CCCCC1)S(=O)(=O)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22-36 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| N-Boc-|A-(phenylsulfonyl)cyclohexylmethylamine |
| N-Boc-|A-(phenylsulfonyl)-cyclohexylmethylamin |
| tert-Butyl cyclohexyl(phenylsulfonyl)methylcarbamate |
| [Cyclohexyl(phenylsulfonyl)methyl]carbamic acid tert butyl ester |
| [cyclohexyl(benzenesulfonyl)methyl]carbamic acid tert-butyl ester |
| Benzenesulfonyl(cyclohexyl)methylcarbamic acid tert butyl ester |
