Introduction：Basic information about CAS 166668-33-3|T-BUTYL TRANS-17-BROMO-4 7 10 13-TETRAOX, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | T-BUTYL TRANS-17-BROMO-4 7 10 13-TETRAOX |
|---|
| CAS Number | 166668-33-3 | Molecular Weight | 411.32800 |
|---|
| Density | 1.182 g/mL at 20ºC(lit.) | Boiling Point | 442.335ºC at 760 mmHg |
|---|
| Molecular Formula | C17H31BrO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.317ºC |
|---|
Names
| Name | tert-butyl 3-[2-[2-[2-(4-bromobut-2-enoxy)ethoxy]ethoxy]ethoxy]propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.182 g/mL at 20ºC(lit.) |
|---|
| Boiling Point | 442.335ºC at 760 mmHg |
|---|
| Molecular Formula | C17H31BrO6 |
|---|
| Molecular Weight | 411.32800 |
|---|
| Flash Point | 221.317ºC |
|---|
| Exact Mass | 410.13000 |
|---|
| PSA | 63.22000 |
|---|
| LogP | 2.73570 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.475 |
|---|
| InChIKey | ZCDCGWNGIROULA-SNAWJCMRSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCC=CCBr |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (E)-17-bromo-4,7,10,13-tetraoxa-15-heptadecenoic acid tert-butyl ester |
| tert-butyl (E)-17-bromo-4,7,10,13-tetraoxa-15-heptadecenoate |
| tert-Butyl trans-17-bromo-4,7,10,13-tetraoxa-15-heptadecenoate |
| 3-(2-{2-[2-(4-bromo-but-2-enyloxy)-ethoxy]-ethoxy}-ethoxy)-propionic acid tert-butyl ester |
