Introduction：Basic information about CAS 313337-34-7|4-Fluoro-1H-indole-7-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoro-1H-indole-7-carboxylic acid |
|---|
| CAS Number | 313337-34-7 | Molecular Weight | 179.148 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 421.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.7±23.2 °C |
|---|
Names
| Name | 4-fluoro-1H-indole-7-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 421.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 |
|---|
| Molecular Weight | 179.148 |
|---|
| Flash Point | 208.7±23.2 °C |
|---|
| Exact Mass | 179.038254 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 1.99 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.692 |
|---|
| InChIKey | GDLCLHCOKQFBPI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(F)c2cc[nH]c12 |
|---|
Synonyms
| PC6002 |
| 7-Carboxy-4-fluoro-1H-indole |
| 4-Fluoro-1H-indole-7-carboxylic acid |
| 4-fluoroindole-7-carboxylic acid |
| 4-fluoro-7-carboxyindole |
| 1H-Indole-7-carboxylic acid, 4-fluoro- |
