Introduction：Basic information about CAS 3119-93-5|3-Ethyl-2-Methylbenzothiazolium Iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Ethyl-2-Methylbenzothiazolium Iodide |
|---|
| CAS Number | 3119-93-5 | Molecular Weight | 305.17800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H12INS | Melting Point | 195197°C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-ethyl-2-methyl-1,3-benzothiazol-3-ium,iodide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 195197°C |
|---|
| Molecular Formula | C10H12INS |
|---|
| Molecular Weight | 305.17800 |
|---|
| Exact Mass | 304.97400 |
|---|
| PSA | 32.12000 |
|---|
| InChIKey | HWFCSPDBFXYFKY-UHFFFAOYSA-M |
|---|
| SMILES | CC[n+]1c(C)sc2ccccc21.[I-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-ethyl-2-methyl-1,3-benzothiazolium iodide |
| 3-ethyl-2-methylbenzothiazol-3-ium iodide |
| MFCD00044134 |
| 3-ethyl-2-methylbenzotriazol-3-ium iodide |
| EINECS 221-494-6 |
| 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide |
| N-Ethyl-2-methylbenzothiazolium iodide |
| 3-Ethyl-2-MethylbenzothiazoliuM Iodide |
| 2-methyl-3-ethyl benzothiazolium iodide |
