Introduction：Basic information about CAS 616-69-3|1,2-Dimethyl-3,5-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Dimethyl-3,5-dinitrobenzene |
|---|
| CAS Number | 616-69-3 | Molecular Weight | 196.160 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 334.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.6±19.3 °C |
|---|
Names
| Name | 1,2-dimethyl-3,5-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 334.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O4 |
|---|
| Molecular Weight | 196.160 |
|---|
| Flash Point | 165.6±19.3 °C |
|---|
| Exact Mass | 196.048401 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 2.54 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | FHCBGLKAGXVKHS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,2-Dimethyl-3,5-dinitrobenzene |
| 1,2-Dimethyl-3,5-dinitro-benzene |
| Benzene, 1,2-dimethyl-3,5-dinitro- |
| Benzene,1,2-dimethyl-3,5-dinitro |
| 3,4-dimethyl-1,5-dinitrobenzene |
| 1,2-Dimethyl-3,5-dinitro-benzol |
| 3,5-Dinitro-o-xylol |
| 3,5-Dinitro-o-xylene |
| 2,3-dimethyl-1,5-dinitrobenzene |
| 3.5-Dinitro-1.2-dimethyl-benzol |
