Introduction：Basic information about CAS 256488-46-7|(4-Phenyl-5-(trifluoromethyl)thiophen-2-yl)Methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Phenyl-5-(trifluoromethyl)thiophen-2-yl)Methanol |
|---|
| CAS Number | 256488-46-7 | Molecular Weight | 258.25900 |
|---|
| Density | 1.348g/cm3 | Boiling Point | 304.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9F3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138ºC |
|---|
Names
| Name | [4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.348g/cm3 |
|---|
| Boiling Point | 304.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9F3OS |
|---|
| Molecular Weight | 258.25900 |
|---|
| Flash Point | 138ºC |
|---|
| Exact Mass | 258.03300 |
|---|
| PSA | 48.47000 |
|---|
| LogP | 3.92620 |
|---|
| Vapour Pressure | 0.000382mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | AUJMSBKJCOVWFV-UHFFFAOYSA-N |
|---|
| SMILES | OCc1cc(-c2ccccc2)c(C(F)(F)F)s1 |
|---|
Synonyms
| 4-phenyl-5-trifluoromethylthiophene-2-methanol |
| (4-Phenyl-5-(trifluoromethyl)thiophen-2-yl)methanol |
| 2-(Hydroxymethyl)-4-phenyl-5-(trifluoromethyl)thiophene |
