Introduction：Basic information about CAS 2565-87-9|phosphocitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phosphocitrate |
|---|
| CAS Number | 2565-87-9 | Molecular Weight | 272.10300 |
|---|
| Density | 1.985g/cm3 | Boiling Point | 457.6ºC at 760mmHg |
|---|
| Molecular Formula | C6H9O10P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.5ºC |
|---|
Names
| Name | 2-phosphonooxypropane-1,2,3-tricarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.985g/cm3 |
|---|
| Boiling Point | 457.6ºC at 760mmHg |
|---|
| Molecular Formula | C6H9O10P |
|---|
| Molecular Weight | 272.10300 |
|---|
| Flash Point | 230.5ºC |
|---|
| Exact Mass | 271.99300 |
|---|
| PSA | 188.47000 |
|---|
| Vapour Pressure | 1.21E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | XTRHYDMWPCTCKN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(CC(=O)O)(OP(=O)(O)O)C(=O)O |
|---|
Synonyms
| 2-phosphonooxy-1,2,3-propane tricarboxylic acid |
| 1,2,3-Propanetricarboxylic acid,2-(phosphonooxy) |
| 2-Phosphonooxy-propan-1,2,3-tricarbonsaeure,citric acid |
| phosphocitrate |
| Phosphocitric acid |
| 2-phosphonooxy-propane-1,2,3-tricarboxylic acid |
| 3-carboxy-3-phosphonooxy pentanedioic acid |
