Introduction：Basic information about CAS 25739-67-7|p-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(phenylamino)sulphonyl]phenyl]azo]-5-o, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-[4,5-dihydro-3-methyl-4-[[4-methyl-3-[(phenylamino)sulphonyl]phenyl]azo]-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid |
|---|
| CAS Number | 25739-67-7 | Molecular Weight | 527.57300 |
|---|
| Density | 1.5g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C23H21N5O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[3-methyl-4-[[4-methyl-3-(phenylsulfamoyl)phenyl]diazenyl]-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Molecular Formula | C23H21N5O6S2 |
|---|
| Molecular Weight | 527.57300 |
|---|
| Exact Mass | 527.09300 |
|---|
| PSA | 174.69000 |
|---|
| LogP | 5.65270 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | DNNYNDQWWWDTPP-UHFFFAOYSA-N |
|---|
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1N=Nc1ccc(C)c(S(=O)(=O)Nc2ccccc2)c1 |
|---|
