Introduction:Basic information about CAS 25811-35-2|2,2-bis[[(1-oxoheptyl)oxy]methyl]propane-1,3-diyl bisheptanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-bis[[(1-oxoheptyl)oxy]methyl]propane-1,3-diyl bisheptanoate |
|---|
| CAS Number | 25811-35-2 | Molecular Weight | 584.82500 |
|---|
| Density | 0.995g/cm3 | Boiling Point | 618ºC at 760mmHg |
|---|
| Molecular Formula | C33H60O8 | Melting Point | -1.5--0.5ºC |
|---|
| MSDS | / | Flash Point | 249.7ºC |
|---|
Names
| Name | [3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propyl] heptanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.995g/cm3 |
|---|
| Boiling Point | 618ºC at 760mmHg |
|---|
| Melting Point | -1.5--0.5ºC |
|---|
| Molecular Formula | C33H60O8 |
|---|
| Molecular Weight | 584.82500 |
|---|
| Flash Point | 249.7ºC |
|---|
| Exact Mass | 584.42900 |
|---|
| PSA | 105.20000 |
|---|
| LogP | 8.02720 |
|---|
| Vapour Pressure | 3.35E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.463 |
|---|
| InChIKey | NCGQPNAQUYGWMI-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCC(=O)OCC(COC(=O)CCCCCC)(COC(=O)CCCCCC)COC(=O)CCCCCC |
|---|
Safety Information
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,2-Bis(((1-oxoheptyl)oxy)methyl)propane-1,3-diyl bisheptanoate |
| Pentaerythritol tetra-n-heptanoate |
| Pentaerythritol tetraheptanoate |
| Heptansaeure-pentaerythritolester |
| 3-(heptanoyloxy)-2,2-bis[(heptanoyloxy)methyl]propyl heptanoate |
| Tetra-O-heptanoyl-pentaerythrit |
| EINECS 247-279-7 |
| Pentaerythrit-tetraheptanoat |
| tetra-O-heptanoyl-pentaerythritol |