Introduction：Basic information about CAS 36765-89-6|2-ethylhexanoyl 2-ethylhexanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ethylhexanoyl 2-ethylhexanoate |
|---|
| CAS Number | 36765-89-6 | Molecular Weight | 270.40800 |
|---|
| Density | 0.919g/cm3 | Boiling Point | 300.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H30O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.8ºC |
|---|
Names
| Name | 2-ethylhexanoyl 2-ethylhexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.919g/cm3 |
|---|
| Boiling Point | 300.3ºC at 760mmHg |
|---|
| Molecular Formula | C16H30O3 |
|---|
| Molecular Weight | 270.40800 |
|---|
| Flash Point | 135.8ºC |
|---|
| Exact Mass | 270.21900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 4.48900 |
|---|
| Index of Refraction | 1.4335-1.4355 |
|---|
| InChIKey | TVPCUVQDVRZTAL-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)C(=O)OC(=O)C(CC)CCCC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 24/25 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-Ethylhexanoic anhydride |
| TVPCUVQDVRZTAL-UHFFFAOYSA |
| EINECS 253-195-1 |
| 2-ethylhexanoyl anhydride |
| 2-ethyl-hexanoic acid-anhydride |
| 2-Aethyl-hexansaeure-anhydrid |
| (2-Ethyl-hexansaeure)-anhydrid |
| Hexanoic acid,2-ethyl-,anhydride |
| 2-ethylhexanoic anhydride |
| MFCD00043963 |
