Introduction：Basic information about CAS 13669-62-0|4-Chloro-6-methoxy quinoline-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-methoxy quinoline-3-carbonitrile |
|---|
| CAS Number | 13669-62-0 | Molecular Weight | 218.63900 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C11H7ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.8ºC |
|---|
Names
| Name | 4-chloro-6-methoxyquinoline-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C11H7ClN2O |
|---|
| Molecular Weight | 218.63900 |
|---|
| Flash Point | 186.8ºC |
|---|
| Exact Mass | 218.02500 |
|---|
| PSA | 45.91000 |
|---|
| LogP | 2.76848 |
|---|
| Vapour Pressure | 3.84E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | VIKNILFXAQPQEF-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2ncc(C#N)c(Cl)c2c1 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Quinolinecarbonitrile,4-chloro-6-methoxy |
| 3-Cyan-4-chlor-6-methoxy-chinolin |
| 3-Cyan-4-cyan-6-methoxy-chinolin |
| 4-chloro-6-methoxy-quinoline-3-carbonitrile |
| 4-chloro-6-(methyloxy)-3-quinolinecarbonitrile |
| 4-chloro-6-methoxy-3-quinolinecarbonitrile |
