Introduction:Basic information about CAS 6161-50-8|1,1'-Biphenyl, 3,3'-dimethoxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1'-Biphenyl, 3,3'-dimethoxy- |
|---|
| CAS Number | 6161-50-8 | Molecular Weight | 214.26000 |
|---|
| Density | 1.056g/cm3 | Boiling Point | 328ºC(lit.) |
|---|
| Molecular Formula | C14H14O2 | Melting Point | 44-45ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
Names
| Name | 1-methoxy-3-(3-methoxyphenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.056g/cm3 |
|---|
| Boiling Point | 328ºC(lit.) |
|---|
| Melting Point | 44-45ºC(lit.) |
|---|
| Molecular Formula | C14H14O2 |
|---|
| Molecular Weight | 214.26000 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 214.09900 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.37080 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | UCHNVSDXSPIKRG-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(-c2cccc(OC)c2)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Biphenyl,3,3'-dimethoxy |
| MFCD00008391 |
| 1,1'-Biphenyl,3,3'-dimethoxy |
| 3,3'-bis(methoxy)biphenyl |
| EINECS 228-187-6 |
| Biphenyl,3'-dimethoxy |
| 3,3'-Bianisole |
| 3,3'-Dimethoxybiphenyl |
| 3,3'-Dimethoxy-1,1'-biphenyl |