Introduction:Basic information about CAS 1693-28-3|2-Trifluoromethyl thioxanthone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Trifluoromethyl thioxanthone |
|---|
| CAS Number | 1693-28-3 | Molecular Weight | 280.265 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 375.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H7F3OS | Melting Point | 147-151 °C(lit.) |
|---|
| MSDS | / | Flash Point | 180.7±27.9 °C |
|---|
Names
| Name | 2-(Trifluoromethyl)thioxanthen-9-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 375.1±42.0 °C at 760 mmHg |
|---|
| Melting Point | 147-151 °C(lit.) |
|---|
| Molecular Formula | C14H7F3OS |
|---|
| Molecular Weight | 280.265 |
|---|
| Flash Point | 180.7±27.9 °C |
|---|
| Exact Mass | 280.016968 |
|---|
| PSA | 45.31000 |
|---|
| LogP | 4.56 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | NEWRXGDGZGIHIS-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c2ccccc2sc2ccc(C(F)(F)F)cc12 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-(trifluoromethyl)thioxanthen-9-one |
| 2-(trifluoromethyl)-10H-dibenzo[b,e]thiin-10-one |
| 2-Trifluoromethyl thioxanthone |
| 2-trifluoromethylthioxanthone |
| 9H-Thioxanthen-9-one, 2-(trifluoromethyl)- |
| MFCD00079785 |
| EINECS 216-893-7 |
| 2-(Trifluoromethyl)-9H-thioxanthen-9-one |
| 2-Trifluoromethyl thioxanthone |