Introduction：Basic information about CAS 135-65-9|2-Naphthanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Naphthanilide |
|---|
| CAS Number | 135-65-9 | Molecular Weight | 308.28800 |
|---|
| Density | 1.449g/cm3 | Boiling Point | 448ºC at 760mmHg |
|---|
| Molecular Formula | C17H12N2O4 | Melting Point | 246-247°C |
|---|
| MSDS | / | Flash Point | 224.7ºC |
|---|
Names
| Name | 3-Hydroxy-3'-nitro-2-naphthanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.449g/cm3 |
|---|
| Boiling Point | 448ºC at 760mmHg |
|---|
| Melting Point | 246-247°C |
|---|
| Molecular Formula | C17H12N2O4 |
|---|
| Molecular Weight | 308.28800 |
|---|
| Flash Point | 224.7ºC |
|---|
| Exact Mass | 308.08000 |
|---|
| PSA | 95.15000 |
|---|
| LogP | 4.30210 |
|---|
| Vapour Pressure | 1.21E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.755 |
|---|
| InChIKey | YZJSKRBKHCLMQC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc2ccccc2cc1O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. |
|---|
| Safety Phrases | S23-S24 |
|---|
| RIDADR | 2810 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | BX3500000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00021637 |
| 3-Hydroxy-N-(3-nitrophenyl)-2-naphthamide |
| 3-Hydroxy-N-(3-nitrophenyl)-2-naphthalenecarboxamide |
| 3-HYDROXY-3'-NITRO-2-NAPHTHANILIDE |
| 3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| 2-Hydroxy-3-naphthoic Acid m-Nitroanilide |
| Azoic Coupling Component 17 |
| Naphthol AS-BS |
| EINECS 205-209-2 |
