Introduction:Basic information about CAS 137-52-0|Naphtanilide EL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naphtanilide EL |
|---|
| CAS Number | 137-52-0 | Molecular Weight | 327.76200 |
|---|
| Density | 1.384 g/cm3 | Boiling Point | 446.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.7ºC |
|---|
Names
| Name | N-(5-chloro-2-methoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.384 g/cm3 |
|---|
| Boiling Point | 446.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClNO3 |
|---|
| Molecular Weight | 327.76200 |
|---|
| Flash Point | 223.7ºC |
|---|
| Exact Mass | 327.06600 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 4.53270 |
|---|
| Vapour Pressure | 1.39E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | WWXPGBMLOCYWLD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cc2ccccc2cc1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
|---|
| Safety Phrases | S26-S36-S24/25 |
|---|
| RIDADR | 3439.0 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | LT7031100 |
|---|
| HS Code | 29321900 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Naphtanilide EL |
| 3-hydroxy-[2]naphthoic acid-(5-chloro-2-methoxy-anilide) |
| 3-Hydroxy-[2]naphthoesaeure-(5-chlor-2-methoxy-anilid) |
| 5'-chloro-3-hydroxy-2'-methoxy-2-naphthanilide |
| Naphthanilid EL |
| Azotol XA |
| Naphthazol NEL |
| Cibanaphthol RCA |
| Naphtazol EL |
| 3-Oxy-naphthoesaeure-(2)-(5-chlor-2-methoxy-anilid) |
| Naphthol AS-CA |
| Acna Naphthol CA |
| N-(5-Chloro-2-methoxyphenyl)-3-hydroxy-2-naphthamide |
| MFCD00043903 |
| Naphthol-NEL |
| Azotol KHA |
| EINECS 224-270-6 |