Introduction:Basic information about CAS 31794-45-3|3-Oxo-3,4-dihydro-2h-1,4-benzoxazine-6-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Oxo-3,4-dihydro-2h-1,4-benzoxazine-6-sulfonyl chloride |
|---|
| CAS Number | 31794-45-3 | Molecular Weight | 247.65600 |
|---|
| Density | 1.582g/cm3 | Boiling Point | 458ºC at 760mmHg |
|---|
| Molecular Formula | C8H6ClNO4S | Melting Point | 178ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.582g/cm3 |
|---|
| Boiling Point | 458ºC at 760mmHg |
|---|
| Melting Point | 178ºC |
|---|
| Molecular Formula | C8H6ClNO4S |
|---|
| Molecular Weight | 247.65600 |
|---|
| Exact Mass | 246.97100 |
|---|
| PSA | 80.85000 |
|---|
| LogP | 2.16380 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | CGTCULUUVYBAPX-UHFFFAOYSA-N |
|---|
| SMILES | O=C1COc2ccc(S(=O)(=O)Cl)cc2N1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | C,Xi |
|---|
| Risk Phrases | R14 |
|---|
| Safety Phrases | 8-22-26-30-36/37/39-45 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-(chlorosulfonyl)-2H,4H-benzo[e]1,4-oxazin-3-one |
| 3-oxo-3,4-dihydro-2H-1,4-benzooxazine-6-sulfonyl chloride |
| 3-oxo-3,4-dihydro-2H-benzo[1,4]oxazine-6-sulfonylchloride |
| 6-Chlorsulfonyl-2H-1,4-benzoxazin-3-on |
| 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-sulfonyl chloride |
| 3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonyl chloride |
| 3,4-Dihydro-3-oxo-2H-1,4-benzoxazine-6-sulphonyl chloride |