Introduction：Basic information about CAS 36983-36-5|ETHYL 2,4-DIOXO-4-(2-THIENYL)BUTANOATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ETHYL 2,4-DIOXO-4-(2-THIENYL)BUTANOATE |
|---|
| CAS Number | 36983-36-5 | Molecular Weight | 226.24900 |
|---|
| Density | 1.277g/cm3 | Boiling Point | 375.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H10O4S | Melting Point | 34ºC |
|---|
| MSDS | / | Flash Point | 181.1ºC |
|---|
Names
| Name | ethyl 2,4-dioxo-4-thiophen-2-ylbutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.277g/cm3 |
|---|
| Boiling Point | 375.9ºC at 760mmHg |
|---|
| Melting Point | 34ºC |
|---|
| Molecular Formula | C10H10O4S |
|---|
| Molecular Weight | 226.24900 |
|---|
| Flash Point | 181.1ºC |
|---|
| Exact Mass | 226.03000 |
|---|
| PSA | 88.68000 |
|---|
| LogP | 1.45310 |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | GCCFYXYKJZUHMI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)CC(=O)c1cccs1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,4-Dioxo-4-thiophen-2-yl-butyric acid ethyl ester |
| 2,4-dioxo-4-[2]thienyl-butyric acid ethyl ester |
| ethyl 2,4-dioxo-4-(2-thienyl)butyrate |
| ethyl 2-thenoylpyruvate |
| ethyl 2,4-dioxo-4-(2-thienyl)butanoate |
| ethyl 2,4-dioxo-4-(thiophen-2-yl)butanoate |
| ethyl 2-thionylpyruvate |
| Ethyla,g-dioxo-2-thiophenebutanoate |
