Introduction:Basic information about CAS 36094-04-9|2-phenyl-1,3-thiazole-4-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-phenyl-1,3-thiazole-4-carbonyl chloride |
|---|
| CAS Number | 36094-04-9 | Molecular Weight | 223.67900 |
|---|
| Density | 1.365g/cm3 | Boiling Point | 358.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H6ClNOS | Melting Point | 100ºC |
|---|
| MSDS | USA | Flash Point | 170.5ºC |
|---|
Names
| Name | 2-phenyl-1,3-thiazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.365g/cm3 |
|---|
| Boiling Point | 358.3ºC at 760mmHg |
|---|
| Melting Point | 100ºC |
|---|
| Molecular Formula | C10H6ClNOS |
|---|
| Molecular Weight | 223.67900 |
|---|
| Flash Point | 170.5ºC |
|---|
| Exact Mass | 222.98600 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 3.18910 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | ZZFOIDMEHXGBKS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1csc(-c2ccccc2)n1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-phenyl-thiazole-4-carbonyl chloride |
| 2-phenyl-1,3-thiazole-4-carboxylic acid chloride |
| 4-Thiazolecarbonylchloride,2-phenyl |
| 2-phenyl-4-thiazolecarboxylic acid chloride |
| 2-phenyl-thiazole-4-carboxylic acid chloride |
| MFCD02681968 |
| 2-phenyl-1,3-thiazol-4-carbonyl chloride |
| 2-Phenyl-thiazol-4-carbonylchlorid |