Introduction：Basic information about CAS 136745-20-5|4-(2,2-DIMETHOXYETHYL)-5-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2,2-DIMETHOXYETHYL)-5-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL |
|---|
| CAS Number | 136745-20-5 | Molecular Weight | 265.33100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 351.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.5ºC |
|---|
Names
| Name | 4-(2,2-dimethoxyethyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 351.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3O2S |
|---|
| Molecular Weight | 265.33100 |
|---|
| Flash Point | 166.5ºC |
|---|
| Exact Mass | 265.08800 |
|---|
| PSA | 87.97000 |
|---|
| LogP | 1.85270 |
|---|
| Vapour Pressure | 4.03E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | CJEIRWZHMRYHDH-UHFFFAOYSA-N |
|---|
| SMILES | COC(Cn1c(-c2ccccc2)n[nH]c1=S)OC |
|---|
Synonyms
| HMS1533L06 |
| 4-(2,2-dimethoxyethyl)-5-phenyl-1,2,4-triazole-3-thiol |
| 4-(2,2-dimethoxyethyl)-5-phenyl-4H-1,2,4-triazole-3-thiol |
