Introduction:Basic information about CAS 1666-17-7|Benzenesulfonic acid,4-methyl-, 2-(phenylmethylene)hydrazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-methyl-, 2-(phenylmethylene)hydrazide |
|---|
| CAS Number | 1666-17-7 | Molecular Weight | 274.338 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14N2O2S | Melting Point | 130ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 214.9±26.8 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | benzaldehyde tosylhydrazone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 431.8±38.0 °C at 760 mmHg |
|---|
| Melting Point | 130ºC |
|---|
| Molecular Formula | C14H14N2O2S |
|---|
| Molecular Weight | 274.338 |
|---|
| Flash Point | 214.9±26.8 °C |
|---|
| Exact Mass | 274.077606 |
|---|
| PSA | 66.91000 |
|---|
| LogP | 3.35 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | FZFLTDNAHASQQC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2ccccc2)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-Methyl-N'-[(E)-phenylmethylene]benzenesulfonohydrazide |
| Benzenesulfonic acid, 4-methyl-, 2-[(1E)-phenylmethylene]hydrazide |
| benzaldehyde (p-tosyl)hydrazone |
| N'-Benzylidene-p-toluenesulfonic acid hydrazide |
| N2-Benzylidene-4-methylbenzenesulfonohydrazide |
| p-Toluenesulfonic acid N'-benzylidene hydrazide |
| benzaldehyde toluene-p-sulphonylhydrazone |
| N'-Benzylidene-4-methylbenzenesulfonohydrazide |
| Benzaldehyde p-Toluenesulfonylhydrazone |
| N-(benzylideneamino)-4-methyl-benzenesulfonamide |
| 4-methyl-N'-benzylidenebenzene-1-sulfonohydrazide |
| 4-methylbenzenesulfonic acid N-methylidene-hydrazide |
| N-benzylideneamino-p-toluenesulfonamide |
| 4-methyl-N-(phenylmethylideneamino)benzenesulfonamide |
| Benzaldehyde Tosylhydrazone |
| Benzaldehyde [(4-methylphenyl)sulfonyl]hydrazone |
| MFCD00009644 |