Introduction:Basic information about CAS 185968-90-5|ZD-Dap(Fmoc)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZD-Dap(Fmoc)-OH |
|---|
| CAS Number | 185968-90-5 | Molecular Weight | 460.479 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 723.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H24N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 391.0±32.9 °C |
|---|
Names
| Name | (2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 723.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H24N2O6 |
|---|
| Molecular Weight | 460.479 |
|---|
| Flash Point | 391.0±32.9 °C |
|---|
| Exact Mass | 460.163422 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 5.68 |
|---|
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | MVKNXKRRMCSKJJ-HSZRJFAPSA-N |
|---|
| SMILES | O=C(NCC(NC(=O)OCc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(((benzyloxy)carbonyl)amino)propanoic acid |
| (R)-3-(9-fluorenylmethoxycarbonylamino)-2-(benzyloxycarbonylamino)propanoic acid |
| N-[(Benzyloxy)carbonyl]-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-D-alanine |
| AmbotzZAA1068 |
| N3-Fmoc-N2-Cbz-D-2,3-diaminopropionic acid |
| Z-D-Dapa(Fmoc)-OH |
| N-Cbz-N'-Fmoc-D-2,3-diaminopropionic acid |
| D-Alanine, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-N-[(phenylmethoxy)carbonyl]- |