Introduction:Basic information about CAS 25729-13-9|4,4'-Dinonyloxyazoxybenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dinonyloxyazoxybenzene |
|---|
| CAS Number | 25729-13-9 | Molecular Weight | 482.69800 |
|---|
| Density | 1g/cm3 | Boiling Point | 596.4ºC at 760 mmHg |
|---|
| Molecular Formula | C30H46N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.5ºC |
|---|
Names
| Name | (4-nonoxyphenyl)-(4-nonoxyphenyl)imino-oxidoazanium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1g/cm3 |
|---|
| Boiling Point | 596.4ºC at 760 mmHg |
|---|
| Molecular Formula | C30H46N2O3 |
|---|
| Molecular Weight | 482.69800 |
|---|
| Flash Point | 314.5ºC |
|---|
| Exact Mass | 482.35100 |
|---|
| PSA | 59.57000 |
|---|
| LogP | 10.39430 |
|---|
| Vapour Pressure | 1.47E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | KJMHEFPNHRGGGG-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCCOc1ccc(N=[N+]([O-])c2ccc(OCCCCCCCCC)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| p,p'-Dinonyloxyazoxybenzol |
| 4,4'-Dinonyloxyazoxybenzene |
| Dinonyloxyazoxybenzol |
| 4,4'-Dinonyloxy-azoxybenzol |
| 4,4'-Di-n-nonoxyazoxybenzene |