Introduction：Basic information about CAS 13186-19-1|6-O-galloylglucose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-O-galloylglucose |
|---|
| CAS Number | 13186-19-1 | Molecular Weight | 332.26000 |
|---|
| Density | 1.712g/cm3 | Boiling Point | 764.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H16O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 287.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.712g/cm3 |
|---|
| Boiling Point | 764.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H16O10 |
|---|
| Molecular Weight | 332.26000 |
|---|
| Flash Point | 287.5ºC |
|---|
| Exact Mass | 332.07400 |
|---|
| PSA | 184.98000 |
|---|
| Vapour Pressure | 1.37E-24mmHg at 25°C |
|---|
| Index of Refraction | 1.676 |
|---|
| InChIKey | SMZJCCHIPATQCN-LUTQBAROSA-N |
|---|
| SMILES | O=CC(O)C(O)C(O)C(O)COC(=O)c1cc(O)c(O)c(O)c1 |
|---|
