Introduction：Basic information about CAS 39860-99-6|Pipotiazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pipotiazine |
|---|
| CAS Number | 39860-99-6 | Molecular Weight | 475.66700 |
|---|
| Density | 1.236g/cm3 | Boiling Point | 650.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H33N3O3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 347.1ºC |
|---|
Names
| Name | 10-[3-[4-(2-hydroxyethyl)piperidin-1-yl]propyl]-N,N-dimethylphenothiazine-2-sulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.236g/cm3 |
|---|
| Boiling Point | 650.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H33N3O3S2 |
|---|
| Molecular Weight | 475.66700 |
|---|
| Flash Point | 347.1ºC |
|---|
| Exact Mass | 475.19600 |
|---|
| PSA | 97.77000 |
|---|
| LogP | 5.10780 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | JOMHSQGEWSNUKU-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)N(CCCN1CCC(CCO)CC1)c1ccccc1S2 |
|---|
Synonyms
| Pipotiazina [INN-Spanish] |
| Piportil depot |
| Pipotiazinum |
| Pipothiazine |
| Pipotiazine |
| Pipotiazinum [INN-Latin] |
| Pipotiazina |
| Piportil |
| Pipotiazoine |
