Introduction：Basic information about CAS 36292-69-0|Ketazocine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ketazocine |
|---|
| CAS Number | 36292-69-0 | Molecular Weight | 285.38100 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 449.9ºC at 760mmHg |
|---|
| Molecular Formula | C18H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.9ºC |
|---|
Names
| Name | Ketazocine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 449.9ºC at 760mmHg |
|---|
| Molecular Formula | C18H23NO2 |
|---|
| Molecular Weight | 285.38100 |
|---|
| Flash Point | 225.9ºC |
|---|
| Exact Mass | 285.17300 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 2.90450 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | HQBZLVPZOGIAIQ-SDDDUWNISA-N |
|---|
| SMILES | CC1C2C(=O)c3ccc(O)cc3C1(C)CCN2CC1CC1 |
|---|
Synonyms
| MCV-4513 |
| Ketocyclazocine |
| (2S,6R,11R)-3-(Cyclopropylmethyl)-3,4,5,6-tetrahydro-8-hydroxy-6,11-dimethyl-2,6-Methano-3-benzazocin-1(2H)-one |
