Introduction：Basic information about CAS 617-10-7|2-[(3-nitrobenzoyl)amino]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(3-nitrobenzoyl)amino]acetate |
|---|
| CAS Number | 617-10-7 | Molecular Weight | 224.17000 |
|---|
| Density | / | Boiling Point | 503.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.3ºC |
|---|
Names
| Name | (3-nitro-benzoylamino)-acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 503.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8N2O5 |
|---|
| Molecular Weight | 224.17000 |
|---|
| Flash Point | 258.3ºC |
|---|
| Exact Mass | 224.04300 |
|---|
| PSA | 112.22000 |
|---|
| LogP | 1.32330 |
|---|
| InChIKey | GSVGZXWNWOCWGJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CNC(=O)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Nitro-hippursaeure |
| 3-Nitro-benzaminoessigsaeure |
| 3-Nitro-4-heptanol |
| N-(3-Nitro-benzoyl)-glycin |
| 3-nitrohippuric acid |
| 3-nitro-heptan-4-ol |
| 4-Heptanol,3-nitro |
| 3-nitro-benzoyl glycine |
| N-(3-Nitrobenzoyl)glycine |
